C16H20ClN3 — CID 151469132
4-chloro-7-[[(3S)-3,5-dimethylpiperazin-1-yl]methyl]quinoline (PubChem CID 151469132) has the molecular formula C16H20ClN3 and a molecular weight of 289.81 g/mol. Its IUPAC name is 4-chloro-7-[[(3S)-3,5-dimethylpiperazin-1-yl]methyl]quinoline.
| Compound Name | 4-chloro-7-[[(3S)-3,5-dimethylpiperazin-1-yl]methyl]quinoline |
|---|---|
| PubChem CID | 151469132 |
| Molecular Formula | C16H20ClN3 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 4-chloro-7-[[(3S)-3,5-dimethylpiperazin-1-yl]methyl]quinoline |
| SMILES | CC1CN(Cc2ccc3c(Cl)ccnc3c2)C[C@H](C)N1 |
| InChI | InChI=1S/C16H20ClN3/c1-11-8-20(9-12(2)19-11)10-13-3-4-14-15(17)5-6-18-16(14)7-13/h3-7,11-12,19H,8-10H2,1-2H3/t11-,12?/m0/s1 |
| InChIKey | PKCBKWVYOLKWES-PXYINDEMSA-N |
| XLogP | 3.07 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |