C19H20ClN3O3 — CID 20680699
(3R)-N-tert-butyl-1-[(4-chloroquinolin-7-yl)methyl]-2,4-dioxopyrrolidine-3-carboxamide (PubChem CID 20680699) has the molecular formula C19H20ClN3O3 and a molecular weight of 373.84 g/mol. Its IUPAC name is (3R)-N-tert-butyl-1-[(4-chloroquinolin-7-yl)methyl]-2,4-dioxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-tert-butyl-1-[(4-chloroquinolin-7-yl)methyl]-2,4-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 20680699 |
| Molecular Formula | C19H20ClN3O3 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | (3R)-N-tert-butyl-1-[(4-chloroquinolin-7-yl)methyl]-2,4-dioxopyrrolidine-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@H]1C(=O)CN(Cc2ccc3c(Cl)ccnc3c2)C1=O |
| InChI | InChI=1S/C19H20ClN3O3/c1-19(2,3)22-17(25)16-15(24)10-23(18(16)26)9-11-4-5-12-13(20)6-7-21-14(12)8-11/h4-8,16H,9-10H2,1-3H3,(H,22,25)/t16-/m1/s1 |
| InChIKey | LTRWCITTZPSHRC-MRXNPFEDSA-N |
| XLogP | 2.33 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|