C21H18Cl2N2O5 — CID 123340080
2-[[1-[[4-(3,4-dichlorophenyl)phenyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid (PubChem CID 123340080) has the molecular formula C21H18Cl2N2O5 and a molecular weight of 449.29 g/mol. Its IUPAC name is 2-[[1-[[4-(3,4-dichlorophenyl)phenyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[1-[[4-(3,4-dichlorophenyl)phenyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 123340080 |
| Molecular Formula | C21H18Cl2N2O5 |
| Molecular Weight | 449.29 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 2-[[1-[[4-(3,4-dichlorophenyl)phenyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C1C(=O)CCN(Cc2ccc(-c3ccc(Cl)c(Cl)c3)cc2)C1=O |
| InChI | InChI=1S/C21H18Cl2N2O5/c22-15-6-5-14(9-16(15)23)13-3-1-12(2-4-13)11-25-8-7-17(26)19(21(25)30)20(29)24-10-18(27)28/h1-6,9,19H,7-8,10-11H2,(H,24,29)(H,27,28) |
| InChIKey | XJZVCAHGEFEMPP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|