C16H14ClF3N2O6 — CID 123445312
2-[[1-[[4-chloro-3-(trifluoromethoxy)phenyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid (PubChem CID 123445312) has the molecular formula C16H14ClF3N2O6 and a molecular weight of 422.74 g/mol. Its IUPAC name is 2-[[1-[[4-chloro-3-(trifluoromethoxy)phenyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[1-[[4-chloro-3-(trifluoromethoxy)phenyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 123445312 |
| Molecular Formula | C16H14ClF3N2O6 |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 2-[[1-[[4-chloro-3-(trifluoromethoxy)phenyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C1C(=O)CCN(Cc2ccc(Cl)c(OC(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C16H14ClF3N2O6/c17-9-2-1-8(5-11(9)28-16(18,19)20)7-22-4-3-10(23)13(15(22)27)14(26)21-6-12(24)25/h1-2,5,13H,3-4,6-7H2,(H,21,26)(H,24,25) |
| InChIKey | CBZXFJLAKRHELK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|