C15H14BrFN2O5 — CID 123236624
2-[[1-[(4-bromo-2-fluorophenyl)methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid (PubChem CID 123236624) has the molecular formula C15H14BrFN2O5 and a molecular weight of 401.19 g/mol. Its IUPAC name is 2-[[1-[(4-bromo-2-fluorophenyl)methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[1-[(4-bromo-2-fluorophenyl)methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 123236624 |
| Molecular Formula | C15H14BrFN2O5 |
| Molecular Weight | 401.19 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 2-[[1-[(4-bromo-2-fluorophenyl)methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C1C(=O)CCN(Cc2ccc(Br)cc2F)C1=O |
| InChI | InChI=1S/C15H14BrFN2O5/c16-9-2-1-8(10(17)5-9)7-19-4-3-11(20)13(15(19)24)14(23)18-6-12(21)22/h1-2,5,13H,3-4,6-7H2,(H,18,23)(H,21,22) |
| InChIKey | QSULLKGEWIAWJW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.19 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|