C17H16F4N2O6 — CID 123866441
2-[[1-[[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid (PubChem CID 123866441) has the molecular formula C17H16F4N2O6 and a molecular weight of 420.32 g/mol. Its IUPAC name is 2-[[1-[[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[1-[[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 123866441 |
| Molecular Formula | C17H16F4N2O6 |
| Molecular Weight | 420.32 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 2-[[1-[[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C1C(=O)CCN(Cc2ccc(OCC(F)(F)F)c(F)c2)C1=O |
| InChI | InChI=1S/C17H16F4N2O6/c18-10-5-9(1-2-12(10)29-8-17(19,20)21)7-23-4-3-11(24)14(16(23)28)15(27)22-6-13(25)26/h1-2,5,14H,3-4,6-8H2,(H,22,27)(H,25,26) |
| InChIKey | ODWMPEXOWWSTON-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.32 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|