C21H19N3O7 — CID 123595924
5-[4-[[3-(carboxymethylcarbamoyl)-2,4-dioxopiperidin-1-yl]methyl]phenyl]pyridine-2-carboxylic acid (PubChem CID 123595924) has the molecular formula C21H19N3O7 and a molecular weight of 425.40 g/mol. Its IUPAC name is 5-[4-[[3-(carboxymethylcarbamoyl)-2,4-dioxopiperidin-1-yl]methyl]phenyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[4-[[3-(carboxymethylcarbamoyl)-2,4-dioxopiperidin-1-yl]methyl]phenyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 123595924 |
| Molecular Formula | C21H19N3O7 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 5-[4-[[3-(carboxymethylcarbamoyl)-2,4-dioxopiperidin-1-yl]methyl]phenyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)CNC(=O)C1C(=O)CCN(Cc2ccc(-c3ccc(C(=O)O)nc3)cc2)C1=O |
| InChI | InChI=1S/C21H19N3O7/c25-16-7-8-24(20(29)18(16)19(28)23-10-17(26)27)11-12-1-3-13(4-2-12)14-5-6-15(21(30)31)22-9-14/h1-6,9,18H,7-8,10-11H2,(H,23,28)(H,26,27)(H,30,31) |
| InChIKey | OEIODMSYEKWHPB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 153.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|