C20H18ClN3O6 — CID 123280608
2-[[1-[[6-(3-chlorophenoxy)-3-pyridinyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid (PubChem CID 123280608) has the molecular formula C20H18ClN3O6 and a molecular weight of 431.83 g/mol. Its IUPAC name is 2-[[1-[[6-(3-chlorophenoxy)-3-pyridinyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[1-[[6-(3-chlorophenoxy)-3-pyridinyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 123280608 |
| Molecular Formula | C20H18ClN3O6 |
| Molecular Weight | 431.83 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 2-[[1-[[6-(3-chlorophenoxy)-3-pyridinyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C1C(=O)CCN(Cc2ccc(Oc3cccc(Cl)c3)nc2)C1=O |
| InChI | InChI=1S/C20H18ClN3O6/c21-13-2-1-3-14(8-13)30-16-5-4-12(9-22-16)11-24-7-6-15(25)18(20(24)29)19(28)23-10-17(26)27/h1-5,8-9,18H,6-7,10-11H2,(H,23,28)(H,26,27) |
| InChIKey | LEEQZCHNGYYXDP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.83 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|