C24H25N3O6 — CID 123192275
2-[[6-[[6-(4-methylphenoxy)-3-pyridinyl]methyl]-7,9-dioxo-6-azaspiro[3.5]nonane-8-carbonyl]amino]acetic acid (PubChem CID 123192275) has the molecular formula C24H25N3O6 and a molecular weight of 451.48 g/mol. Its IUPAC name is 2-[[6-[[6-(4-methylphenoxy)-3-pyridinyl]methyl]-7,9-dioxo-6-azaspiro[3.5]nonane-8-carbonyl]amino]acetic acid.
| Compound Name | 2-[[6-[[6-(4-methylphenoxy)-3-pyridinyl]methyl]-7,9-dioxo-6-azaspiro[3.5]nonane-8-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 123192275 |
| Molecular Formula | C24H25N3O6 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 2-[[6-[[6-(4-methylphenoxy)-3-pyridinyl]methyl]-7,9-dioxo-6-azaspiro[3.5]nonane-8-carbonyl]amino]acetic acid |
| SMILES | Cc1ccc(Oc2ccc(CN3CC4(CCC4)C(=O)C(C(=O)NCC(=O)O)C3=O)cn2)cc1 |
| InChI | InChI=1S/C24H25N3O6/c1-15-3-6-17(7-4-15)33-18-8-5-16(11-25-18)13-27-14-24(9-2-10-24)21(30)20(23(27)32)22(31)26-12-19(28)29/h3-8,11,20H,2,9-10,12-14H2,1H3,(H,26,31)(H,28,29) |
| InChIKey | ZBUPPMLGSSICHG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|