C21H26N2O5 — CID 123687265
2-[[2-[(4-methylphenyl)methyl]-3,5-dioxo-2-azaspiro[5.5]undecane-4-carbonyl]amino]acetic acid (PubChem CID 123687265) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is 2-[[2-[(4-methylphenyl)methyl]-3,5-dioxo-2-azaspiro[5.5]undecane-4-carbonyl]amino]acetic acid.
| Compound Name | 2-[[2-[(4-methylphenyl)methyl]-3,5-dioxo-2-azaspiro[5.5]undecane-4-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 123687265 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 2-[[2-[(4-methylphenyl)methyl]-3,5-dioxo-2-azaspiro[5.5]undecane-4-carbonyl]amino]acetic acid |
| SMILES | Cc1ccc(CN2CC3(CCCCC3)C(=O)C(C(=O)NCC(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C21H26N2O5/c1-14-5-7-15(8-6-14)12-23-13-21(9-3-2-4-10-21)18(26)17(20(23)28)19(27)22-11-16(24)25/h5-8,17H,2-4,9-13H2,1H3,(H,22,27)(H,24,25) |
| InChIKey | GJJDSUVGXVFYIF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|