C25H28N2O5 — CID 123354299
2-[[1-[[4-(4-tert-butylphenyl)phenyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid (PubChem CID 123354299) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 2-[[1-[[4-(4-tert-butylphenyl)phenyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[1-[[4-(4-tert-butylphenyl)phenyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 123354299 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 2-[[1-[[4-(4-tert-butylphenyl)phenyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid |
| SMILES | CC(C)(C)c1ccc(-c2ccc(CN3CCC(=O)C(C(=O)NCC(=O)O)C3=O)cc2)cc1 |
| InChI | InChI=1S/C25H28N2O5/c1-25(2,3)19-10-8-18(9-11-19)17-6-4-16(5-7-17)15-27-13-12-20(28)22(24(27)32)23(31)26-14-21(29)30/h4-11,22H,12-15H2,1-3H3,(H,26,31)(H,29,30) |
| InChIKey | RFCAIWIHIWCOLN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|