C22H22N2O5 — CID 123809168
2-[[1-[(4-benzylphenyl)methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid (PubChem CID 123809168) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is 2-[[1-[(4-benzylphenyl)methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[1-[(4-benzylphenyl)methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 123809168 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2-[[1-[(4-benzylphenyl)methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C1C(=O)CCN(Cc2ccc(Cc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C22H22N2O5/c25-18-10-11-24(22(29)20(18)21(28)23-13-19(26)27)14-17-8-6-16(7-9-17)12-15-4-2-1-3-5-15/h1-9,20H,10-14H2,(H,23,28)(H,26,27) |
| InChIKey | IRSWWXZALZUNCM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|