C15H18ClN3O — CID 174447566
(3S)-4-[(3-chloro-1H-indol-6-yl)methyl]-3-methylpiperazine-2-carbaldehyde (PubChem CID 174447566) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is (3S)-4-[(3-chloro-1H-indol-6-yl)methyl]-3-methylpiperazine-2-carbaldehyde.
| Compound Name | (3S)-4-[(3-chloro-1H-indol-6-yl)methyl]-3-methylpiperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 174447566 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (3S)-4-[(3-chloro-1H-indol-6-yl)methyl]-3-methylpiperazine-2-carbaldehyde |
| SMILES | C[C@H]1C(C=O)NCCN1Cc1ccc2c(Cl)c[nH]c2c1 |
| InChI | InChI=1S/C15H18ClN3O/c1-10-15(9-20)17-4-5-19(10)8-11-2-3-12-13(16)7-18-14(12)6-11/h2-3,6-7,9-10,15,17-18H,4-5,8H2,1H3/t10-,15?/m0/s1 |
| InChIKey | SAHNUYKCWHYMGA-MYHCZTBNSA-N |
| XLogP | 2.18 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|