About ethynylbenzene;6-methyl-1H-indole
ethynylbenzene;6-methyl-1H-indole (PubChem CID 174935936) has the molecular formula C17H15N
and a molecular weight of 233.31 g/mol. Its IUPAC name is ethynylbenzene;6-methyl-1H-indole.
Molecular Properties
| Compound Name | ethynylbenzene;6-methyl-1H-indole |
| PubChem CID | 174935936 |
| Molecular Formula | C17H15N |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | ethynylbenzene;6-methyl-1H-indole |
| SMILES | C#Cc1ccccc1.Cc1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C9H9N.C8H6/c1-7-2-3-8-4-5-10-9(8)6-7;1-2-8-6-4-3-5-7-8/h2-6,10H,1H3;1,3-7H |
| InChIKey | TZAVQRVCXCSZKE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethynylbenzene;6-methyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethynylbenzene;6-methyl-1H-indole?
The IUPAC name of ethynylbenzene;6-methyl-1H-indole (CID 174935936) is ethynylbenzene;6-methyl-1H-indole.
What is the SMILES notation for ethynylbenzene;6-methyl-1H-indole?
The canonical SMILES for ethynylbenzene;6-methyl-1H-indole is C#Cc1ccccc1.Cc1ccc2cc[nH]c2c1.
What is the InChIKey of ethynylbenzene;6-methyl-1H-indole?
The InChIKey is TZAVQRVCXCSZKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.C8H6/c1-7-2-3-8-4-5-10-9(8)6-7;1-2-8-6-4-3-5-7-8/h2-6,10H,1H3;1,3-7H.
What are the key properties of ethynylbenzene;6-methyl-1H-indole?
ethynylbenzene;6-methyl-1H-indole has a molecular weight of 233.31 g/mol, XLogP of 4.14, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethynylbenzene;6-methyl-1H-indole is sourced from PubChem (CID 174935936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).