About 1H-pyrrolo[3,2-g]quinoline;dihydrobromide
1H-pyrrolo[3,2-g]quinoline;dihydrobromide (PubChem CID 67935451) has the molecular formula C11H10Br2N2
and a molecular weight of 330.02 g/mol. Its IUPAC name is 1H-pyrrolo[3,2-g]quinoline;dihydrobromide.
Molecular Properties
| Compound Name | 1H-pyrrolo[3,2-g]quinoline;dihydrobromide |
| PubChem CID | 67935451 |
| Molecular Formula | C11H10Br2N2 |
| Molecular Weight | 330.02 g/mol |
| Exact Mass | 327.92 |
| IUPAC Name | 1H-pyrrolo[3,2-g]quinoline;dihydrobromide |
| SMILES | Br.Br.c1cnc2cc3[nH]ccc3cc2c1 |
| InChI | InChI=1S/C11H8N2.2BrH/c1-2-8-6-9-3-5-13-11(9)7-10(8)12-4-1;;/h1-7,13H;2*1H |
| InChIKey | JZQOIBNMYKGGAZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.02 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-pyrrolo[3,2-g]quinoline;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrolo[3,2-g]quinoline;dihydrobromide?
The IUPAC name of 1H-pyrrolo[3,2-g]quinoline;dihydrobromide (CID 67935451) is 1H-pyrrolo[3,2-g]quinoline;dihydrobromide.
What is the SMILES notation for 1H-pyrrolo[3,2-g]quinoline;dihydrobromide?
The canonical SMILES for 1H-pyrrolo[3,2-g]quinoline;dihydrobromide is Br.Br.c1cnc2cc3[nH]ccc3cc2c1.
What is the InChIKey of 1H-pyrrolo[3,2-g]quinoline;dihydrobromide?
The InChIKey is JZQOIBNMYKGGAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2.2BrH/c1-2-8-6-9-3-5-13-11(9)7-10(8)12-4-1;;/h1-7,13H;2*1H.
What are the key properties of 1H-pyrrolo[3,2-g]quinoline;dihydrobromide?
1H-pyrrolo[3,2-g]quinoline;dihydrobromide has a molecular weight of 330.02 g/mol, XLogP of 3.87, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrolo[3,2-g]quinoline;dihydrobromide is sourced from PubChem (CID 67935451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).