About 3H-pyrrolo[3,2-f]quinoline;dihydrochloride
3H-pyrrolo[3,2-f]quinoline;dihydrochloride (PubChem CID 174959718) has the molecular formula C11H10Cl2N2
and a molecular weight of 241.12 g/mol. Its IUPAC name is 3H-pyrrolo[3,2-f]quinoline;dihydrochloride.
Molecular Properties
| Compound Name | 3H-pyrrolo[3,2-f]quinoline;dihydrochloride |
| PubChem CID | 174959718 |
| Molecular Formula | C11H10Cl2N2 |
| Molecular Weight | 241.12 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 3H-pyrrolo[3,2-f]quinoline;dihydrochloride |
| SMILES | Cl.Cl.c1cnc2ccc3[nH]ccc3c2c1 |
| InChI | InChI=1S/C11H8N2.2ClH/c1-2-8-9-5-7-13-11(9)4-3-10(8)12-6-1;;/h1-7,13H;2*1H |
| InChIKey | NHIKIJZIKNJPPU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.12 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3H-pyrrolo[3,2-f]quinoline;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-pyrrolo[3,2-f]quinoline;dihydrochloride?
The IUPAC name of 3H-pyrrolo[3,2-f]quinoline;dihydrochloride (CID 174959718) is 3H-pyrrolo[3,2-f]quinoline;dihydrochloride.
What is the SMILES notation for 3H-pyrrolo[3,2-f]quinoline;dihydrochloride?
The canonical SMILES for 3H-pyrrolo[3,2-f]quinoline;dihydrochloride is Cl.Cl.c1cnc2ccc3[nH]ccc3c2c1.
What is the InChIKey of 3H-pyrrolo[3,2-f]quinoline;dihydrochloride?
The InChIKey is NHIKIJZIKNJPPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2.2ClH/c1-2-8-9-5-7-13-11(9)4-3-10(8)12-6-1;;/h1-7,13H;2*1H.
What are the key properties of 3H-pyrrolo[3,2-f]quinoline;dihydrochloride?
3H-pyrrolo[3,2-f]quinoline;dihydrochloride has a molecular weight of 241.12 g/mol, XLogP of 3.56, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-pyrrolo[3,2-f]quinoline;dihydrochloride is sourced from PubChem (CID 174959718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).