About quinoline-5-carbaldehyde;hydrochloride
quinoline-5-carbaldehyde;hydrochloride (PubChem CID 174461977) has the molecular formula C10H8ClNO
and a molecular weight of 193.63 g/mol. Its IUPAC name is quinoline-5-carbaldehyde;hydrochloride.
Molecular Properties
| Compound Name | quinoline-5-carbaldehyde;hydrochloride |
| PubChem CID | 174461977 |
| Molecular Formula | C10H8ClNO |
| Molecular Weight | 193.63 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | quinoline-5-carbaldehyde;hydrochloride |
| SMILES | Cl.O=Cc1cccc2ncccc12 |
| InChI | InChI=1S/C10H7NO.ClH/c12-7-8-3-1-5-10-9(8)4-2-6-11-10;/h1-7H;1H |
| InChIKey | DMEHXRYFZXEGNO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.63 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze quinoline-5-carbaldehyde;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline-5-carbaldehyde;hydrochloride?
The IUPAC name of quinoline-5-carbaldehyde;hydrochloride (CID 174461977) is quinoline-5-carbaldehyde;hydrochloride.
What is the SMILES notation for quinoline-5-carbaldehyde;hydrochloride?
The canonical SMILES for quinoline-5-carbaldehyde;hydrochloride is Cl.O=Cc1cccc2ncccc12.
What is the InChIKey of quinoline-5-carbaldehyde;hydrochloride?
The InChIKey is DMEHXRYFZXEGNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO.ClH/c12-7-8-3-1-5-10-9(8)4-2-6-11-10;/h1-7H;1H.
What are the key properties of quinoline-5-carbaldehyde;hydrochloride?
quinoline-5-carbaldehyde;hydrochloride has a molecular weight of 193.63 g/mol, XLogP of 2.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline-5-carbaldehyde;hydrochloride is sourced from PubChem (CID 174461977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).