C16H12N4 — CID 58087251
N-(1H-pyrrolo[2,3-b]pyridin-5-yl)quinolin-6-amine (PubChem CID 58087251) has the molecular formula C16H12N4 and a molecular weight of 260.30 g/mol. Its IUPAC name is N-(1H-pyrrolo[2,3-b]pyridin-5-yl)quinolin-6-amine.
| Compound Name | N-(1H-pyrrolo[2,3-b]pyridin-5-yl)quinolin-6-amine |
|---|---|
| PubChem CID | 58087251 |
| Molecular Formula | C16H12N4 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-(1H-pyrrolo[2,3-b]pyridin-5-yl)quinolin-6-amine |
| SMILES | c1cnc2ccc(Nc3cnc4[nH]ccc4c3)cc2c1 |
| InChI | InChI=1S/C16H12N4/c1-2-11-8-13(3-4-15(11)17-6-1)20-14-9-12-5-7-18-16(12)19-10-14/h1-10,20H,(H,18,19) |
| InChIKey | YZFDTNWPZKDCLN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |