C14H13N3S — CID 59506846
N-(3-methylsulfanylphenyl)-1H-pyrrolo[2,3-b]pyridin-5-amine (PubChem CID 59506846) has the molecular formula C14H13N3S and a molecular weight of 255.35 g/mol. Its IUPAC name is N-(3-methylsulfanylphenyl)-1H-pyrrolo[2,3-b]pyridin-5-amine.
| Compound Name | N-(3-methylsulfanylphenyl)-1H-pyrrolo[2,3-b]pyridin-5-amine |
|---|---|
| PubChem CID | 59506846 |
| Molecular Formula | C14H13N3S |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-(3-methylsulfanylphenyl)-1H-pyrrolo[2,3-b]pyridin-5-amine |
| SMILES | CSc1cccc(Nc2cnc3[nH]ccc3c2)c1 |
| InChI | InChI=1S/C14H13N3S/c1-18-13-4-2-3-11(8-13)17-12-7-10-5-6-15-14(10)16-9-12/h2-9,17H,1H3,(H,15,16) |
| InChIKey | XEZJHNMXAZJYOU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |