C13H10N2S — CID 59128709
5-phenylsulfanyl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 59128709) has the molecular formula C13H10N2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 5-phenylsulfanyl-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-phenylsulfanyl-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 59128709 |
| Molecular Formula | C13H10N2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 5-phenylsulfanyl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | c1ccc(Sc2cnc3[nH]ccc3c2)cc1 |
| InChI | InChI=1S/C13H10N2S/c1-2-4-11(5-3-1)16-12-8-10-6-7-14-13(10)15-9-12/h1-9H,(H,14,15) |
| InChIKey | QDVMTDLOWNMWRP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |