About 5-fluoro-1H-indole;pyridine;quinoline
5-fluoro-1H-indole;pyridine;quinoline (PubChem CID 174896082) has the molecular formula C22H18FN3
and a molecular weight of 343.41 g/mol. Its IUPAC name is 5-fluoro-1H-indole;pyridine;quinoline.
Molecular Properties
| Compound Name | 5-fluoro-1H-indole;pyridine;quinoline |
| PubChem CID | 174896082 |
| Molecular Formula | C22H18FN3 |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 5-fluoro-1H-indole;pyridine;quinoline |
| SMILES | Fc1ccc2[nH]ccc2c1.c1ccc2ncccc2c1.c1ccncc1 |
| InChI | InChI=1S/C9H7N.C8H6FN.C5H5N/c1-2-6-9-8(4-1)5-3-7-10-9;9-7-1-2-8-6(5-7)3-4-10-8;1-2-4-6-5-3-1/h1-7H;1-5,10H;1-5H |
| InChIKey | WLZKDAZBOSZTIS-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-1H-indole;pyridine;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1H-indole;pyridine;quinoline?
The IUPAC name of 5-fluoro-1H-indole;pyridine;quinoline (CID 174896082) is 5-fluoro-1H-indole;pyridine;quinoline.
What is the SMILES notation for 5-fluoro-1H-indole;pyridine;quinoline?
The canonical SMILES for 5-fluoro-1H-indole;pyridine;quinoline is Fc1ccc2[nH]ccc2c1.c1ccc2ncccc2c1.c1ccncc1.
What is the InChIKey of 5-fluoro-1H-indole;pyridine;quinoline?
The InChIKey is WLZKDAZBOSZTIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C8H6FN.C5H5N/c1-2-6-9-8(4-1)5-3-7-10-9;9-7-1-2-8-6(5-7)3-4-10-8;1-2-4-6-5-3-1/h1-7H;1-5,10H;1-5H.
What are the key properties of 5-fluoro-1H-indole;pyridine;quinoline?
5-fluoro-1H-indole;pyridine;quinoline has a molecular weight of 343.41 g/mol, XLogP of 5.62, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1H-indole;pyridine;quinoline is sourced from PubChem (CID 174896082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).