About ethane;5-fluoro-1H-indole;molecular hydrogen
ethane;5-fluoro-1H-indole;molecular hydrogen (PubChem CID 144540127) has the molecular formula C10H14FN
and a molecular weight of 167.23 g/mol. Its IUPAC name is ethane;5-fluoro-1H-indole;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;5-fluoro-1H-indole;molecular hydrogen |
| PubChem CID | 144540127 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | ethane;5-fluoro-1H-indole;molecular hydrogen |
| SMILES | CC.Fc1ccc2[nH]ccc2c1.[H][H] |
| InChI | InChI=1S/C8H6FN.C2H6.H2/c9-7-1-2-8-6(5-7)3-4-10-8;1-2;/h1-5,10H;1-2H3;1H |
| InChIKey | NCBVCGLJZVTEDJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;5-fluoro-1H-indole;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-fluoro-1H-indole;molecular hydrogen?
The IUPAC name of ethane;5-fluoro-1H-indole;molecular hydrogen (CID 144540127) is ethane;5-fluoro-1H-indole;molecular hydrogen.
What is the SMILES notation for ethane;5-fluoro-1H-indole;molecular hydrogen?
The canonical SMILES for ethane;5-fluoro-1H-indole;molecular hydrogen is CC.Fc1ccc2[nH]ccc2c1.[H][H].
What is the InChIKey of ethane;5-fluoro-1H-indole;molecular hydrogen?
The InChIKey is NCBVCGLJZVTEDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FN.C2H6.H2/c9-7-1-2-8-6(5-7)3-4-10-8;1-2;/h1-5,10H;1-2H3;1H.
What are the key properties of ethane;5-fluoro-1H-indole;molecular hydrogen?
ethane;5-fluoro-1H-indole;molecular hydrogen has a molecular weight of 167.23 g/mol, XLogP of 3.58, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-fluoro-1H-indole;molecular hydrogen is sourced from PubChem (CID 144540127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).