ethane;5-fluoro-1H-indole;molecular hydrogen

C10H14FN — CID 144540127

IUPACethane;5-fluoro-1H-indole;molecular hydrogen
SMILESCC.Fc1ccc2[nH]ccc2c1.[H][H]
InChIInChI=1S/C8H6FN.C2H6.H2/c9-7-1-2-8-6(5-7)3-4-10-8;1-2;/h1-5,10H;1-2H3;1H
InChIKeyNCBVCGLJZVTEDJ-UHFFFAOYSA-N
MW167.23 g/mol
LogP3.58
Rot. Bonds

About ethane;5-fluoro-1H-indole;molecular hydrogen

ethane;5-fluoro-1H-indole;molecular hydrogen (PubChem CID 144540127) has the molecular formula C10H14FN and a molecular weight of 167.23 g/mol. Its IUPAC name is ethane;5-fluoro-1H-indole;molecular hydrogen.

Molecular Properties

Compound Nameethane;5-fluoro-1H-indole;molecular hydrogen
PubChem CID144540127
Molecular FormulaC10H14FN
Molecular Weight167.23 g/mol
Exact Mass167.11
IUPAC Nameethane;5-fluoro-1H-indole;molecular hydrogen
SMILESCC.Fc1ccc2[nH]ccc2c1.[H][H]
InChIInChI=1S/C8H6FN.C2H6.H2/c9-7-1-2-8-6(5-7)3-4-10-8;1-2;/h1-5,10H;1-2H3;1H
InChIKeyNCBVCGLJZVTEDJ-UHFFFAOYSA-N
XLogP3.58
TPSA15.79 Ų
H-Bond Donors1
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500167.23
LogP ≤ 53.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 100

Analyze ethane;5-fluoro-1H-indole;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;5-fluoro-1H-indole;molecular hydrogen?
The IUPAC name of ethane;5-fluoro-1H-indole;molecular hydrogen (CID 144540127) is ethane;5-fluoro-1H-indole;molecular hydrogen.
What is the SMILES notation for ethane;5-fluoro-1H-indole;molecular hydrogen?
The canonical SMILES for ethane;5-fluoro-1H-indole;molecular hydrogen is CC.Fc1ccc2[nH]ccc2c1.[H][H].
What is the InChIKey of ethane;5-fluoro-1H-indole;molecular hydrogen?
The InChIKey is NCBVCGLJZVTEDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FN.C2H6.H2/c9-7-1-2-8-6(5-7)3-4-10-8;1-2;/h1-5,10H;1-2H3;1H.
What are the key properties of ethane;5-fluoro-1H-indole;molecular hydrogen?
ethane;5-fluoro-1H-indole;molecular hydrogen has a molecular weight of 167.23 g/mol, XLogP of 3.58, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-fluoro-1H-indole;molecular hydrogen is sourced from PubChem (CID 144540127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).