C14H9F2N — CID 10176960
5-(2,4-difluorophenyl)-1H-indole (PubChem CID 10176960) has the molecular formula C14H9F2N and a molecular weight of 229.23 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-1H-indole.
| Compound Name | 5-(2,4-difluorophenyl)-1H-indole |
|---|---|
| PubChem CID | 10176960 |
| Molecular Formula | C14H9F2N |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 5-(2,4-difluorophenyl)-1H-indole |
| SMILES | Fc1ccc(-c2ccc3[nH]ccc3c2)c(F)c1 |
| InChI | InChI=1S/C14H9F2N/c15-11-2-3-12(13(16)8-11)9-1-4-14-10(7-9)5-6-17-14/h1-8,17H |
| InChIKey | SWNJFBSDBABVKA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |