About 5-fluoro-1H-indole;molecular fluorine
5-fluoro-1H-indole;molecular fluorine (PubChem CID 123133815) has the molecular formula C8H6F3N
and a molecular weight of 173.14 g/mol. Its IUPAC name is 5-fluoro-1H-indole;molecular fluorine.
Molecular Properties
| Compound Name | 5-fluoro-1H-indole;molecular fluorine |
| PubChem CID | 123133815 |
| Molecular Formula | C8H6F3N |
| Molecular Weight | 173.14 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 5-fluoro-1H-indole;molecular fluorine |
| SMILES | FF.Fc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H6FN.F2/c9-7-1-2-8-6(5-7)3-4-10-8;1-2/h1-5,10H; |
| InChIKey | MLKIWYJGGMUYHG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.14 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-fluoro-1H-indole;molecular fluorine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1H-indole;molecular fluorine?
The IUPAC name of 5-fluoro-1H-indole;molecular fluorine (CID 123133815) is 5-fluoro-1H-indole;molecular fluorine.
What is the SMILES notation for 5-fluoro-1H-indole;molecular fluorine?
The canonical SMILES for 5-fluoro-1H-indole;molecular fluorine is FF.Fc1ccc2[nH]ccc2c1.
What is the InChIKey of 5-fluoro-1H-indole;molecular fluorine?
The InChIKey is MLKIWYJGGMUYHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FN.F2/c9-7-1-2-8-6(5-7)3-4-10-8;1-2/h1-5,10H;.
What are the key properties of 5-fluoro-1H-indole;molecular fluorine?
5-fluoro-1H-indole;molecular fluorine has a molecular weight of 173.14 g/mol, XLogP of 3.15, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1H-indole;molecular fluorine is sourced from PubChem (CID 123133815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).