C21H24FN3 — CID 56895741
5-[[4-[(4-fluorophenyl)methyl]-1,4-diazepan-1-yl]methyl]-1H-indole (PubChem CID 56895741) has the molecular formula C21H24FN3 and a molecular weight of 337.44 g/mol. Its IUPAC name is 5-[[4-[(4-fluorophenyl)methyl]-1,4-diazepan-1-yl]methyl]-1H-indole.
| Compound Name | 5-[[4-[(4-fluorophenyl)methyl]-1,4-diazepan-1-yl]methyl]-1H-indole |
|---|---|
| PubChem CID | 56895741 |
| Molecular Formula | C21H24FN3 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 5-[[4-[(4-fluorophenyl)methyl]-1,4-diazepan-1-yl]methyl]-1H-indole |
| SMILES | Fc1ccc(CN2CCCN(Cc3ccc4[nH]ccc4c3)CC2)cc1 |
| InChI | InChI=1S/C21H24FN3/c22-20-5-2-17(3-6-20)15-24-10-1-11-25(13-12-24)16-18-4-7-21-19(14-18)8-9-23-21/h2-9,14,23H,1,10-13,15-16H2 |
| InChIKey | CQICWKJEXZTLKK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |