C26H28FN3O — CID 110094995
8-[(4-fluorophenyl)methyl]-3-(1H-indol-5-ylmethyl)-3,8-diazaspiro[5.6]dodec-10-en-7-one (PubChem CID 110094995) has the molecular formula C26H28FN3O and a molecular weight of 417.53 g/mol. Its IUPAC name is 8-[(4-fluorophenyl)methyl]-3-(1H-indol-5-ylmethyl)-3,8-diazaspiro[5.6]dodec-10-en-7-one.
| Compound Name | 8-[(4-fluorophenyl)methyl]-3-(1H-indol-5-ylmethyl)-3,8-diazaspiro[5.6]dodec-10-en-7-one |
|---|---|
| PubChem CID | 110094995 |
| Molecular Formula | C26H28FN3O |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 8-[(4-fluorophenyl)methyl]-3-(1H-indol-5-ylmethyl)-3,8-diazaspiro[5.6]dodec-10-en-7-one |
| SMILES | O=C1N(Cc2ccc(F)cc2)CC=CCC12CCN(Cc1ccc3[nH]ccc3c1)CC2 |
| InChI | InChI=1S/C26H28FN3O/c27-23-6-3-20(4-7-23)19-30-14-2-1-10-26(25(30)31)11-15-29(16-12-26)18-21-5-8-24-22(17-21)9-13-28-24/h1-9,13,17,28H,10-12,14-16,18-19H2 |
| InChIKey | HZRSJBUWBJLRAT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|