C26H31FN2O2 — CID 129361127
3-[[3-(4-fluorophenyl)phenyl]methyl]-8-(2-methoxyethyl)-3,8-diazaspiro[5.6]dodec-10-en-7-one (PubChem CID 129361127) has the molecular formula C26H31FN2O2 and a molecular weight of 422.54 g/mol. Its IUPAC name is 3-[[3-(4-fluorophenyl)phenyl]methyl]-8-(2-methoxyethyl)-3,8-diazaspiro[5.6]dodec-10-en-7-one.
| Compound Name | 3-[[3-(4-fluorophenyl)phenyl]methyl]-8-(2-methoxyethyl)-3,8-diazaspiro[5.6]dodec-10-en-7-one |
|---|---|
| PubChem CID | 129361127 |
| Molecular Formula | C26H31FN2O2 |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 3-[[3-(4-fluorophenyl)phenyl]methyl]-8-(2-methoxyethyl)-3,8-diazaspiro[5.6]dodec-10-en-7-one |
| SMILES | COCCN1CC=CCC2(CCN(Cc3cccc(-c4ccc(F)cc4)c3)CC2)C1=O |
| InChI | InChI=1S/C26H31FN2O2/c1-31-18-17-29-14-3-2-11-26(25(29)30)12-15-28(16-13-26)20-21-5-4-6-23(19-21)22-7-9-24(27)10-8-22/h2-10,19H,11-18,20H2,1H3 |
| InChIKey | MNUBJXILQJDVFM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|