C21H26FNO3 — CID 16677696
4-(4-fluorophenyl)-1-[[3-(2-methoxyethoxy)phenyl]methyl]piperidin-4-ol (PubChem CID 16677696) has the molecular formula C21H26FNO3 and a molecular weight of 359.44 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1-[[3-(2-methoxyethoxy)phenyl]methyl]piperidin-4-ol.
| Compound Name | 4-(4-fluorophenyl)-1-[[3-(2-methoxyethoxy)phenyl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 16677696 |
| Molecular Formula | C21H26FNO3 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 4-(4-fluorophenyl)-1-[[3-(2-methoxyethoxy)phenyl]methyl]piperidin-4-ol |
| SMILES | COCCOc1cccc(CN2CCC(O)(c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C21H26FNO3/c1-25-13-14-26-20-4-2-3-17(15-20)16-23-11-9-21(24,10-12-23)18-5-7-19(22)8-6-18/h2-8,15,24H,9-14,16H2,1H3 |
| InChIKey | XOAIXLSHFVDHQX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|