C27H34FN3O3 — CID 129454035
1-[[3-[3-(2-ethylimidazol-1-yl)propoxy]phenyl]methyl]-4-[(4-fluorophenoxy)methyl]piperidin-4-ol (PubChem CID 129454035) has the molecular formula C27H34FN3O3 and a molecular weight of 467.59 g/mol. Its IUPAC name is 1-[[3-[3-(2-ethylimidazol-1-yl)propoxy]phenyl]methyl]-4-[(4-fluorophenoxy)methyl]piperidin-4-ol.
| Compound Name | 1-[[3-[3-(2-ethylimidazol-1-yl)propoxy]phenyl]methyl]-4-[(4-fluorophenoxy)methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 129454035 |
| Molecular Formula | C27H34FN3O3 |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 1-[[3-[3-(2-ethylimidazol-1-yl)propoxy]phenyl]methyl]-4-[(4-fluorophenoxy)methyl]piperidin-4-ol |
| SMILES | CCc1nccn1CCCOc1cccc(CN2CCC(O)(COc3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C27H34FN3O3/c1-2-26-29-13-17-31(26)14-4-18-33-25-6-3-5-22(19-25)20-30-15-11-27(32,12-16-30)21-34-24-9-7-23(28)8-10-24/h3,5-10,13,17,19,32H,2,4,11-12,14-16,18,20-21H2,1H3 |
| InChIKey | COGYVJHIPLUJNL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|