C26H33N3O3 — CID 132766922
1-[[3-(2-imidazol-1-ylethoxy)phenyl]methyl]-4-[(4-methylphenoxy)methyl]azepan-4-ol (PubChem CID 132766922) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 1-[[3-(2-imidazol-1-ylethoxy)phenyl]methyl]-4-[(4-methylphenoxy)methyl]azepan-4-ol.
| Compound Name | 1-[[3-(2-imidazol-1-ylethoxy)phenyl]methyl]-4-[(4-methylphenoxy)methyl]azepan-4-ol |
|---|---|
| PubChem CID | 132766922 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 1-[[3-(2-imidazol-1-ylethoxy)phenyl]methyl]-4-[(4-methylphenoxy)methyl]azepan-4-ol |
| SMILES | Cc1ccc(OCC2(O)CCCN(Cc3cccc(OCCn4ccnc4)c3)CC2)cc1 |
| InChI | InChI=1S/C26H33N3O3/c1-22-6-8-24(9-7-22)32-20-26(30)10-3-13-28(14-11-26)19-23-4-2-5-25(18-23)31-17-16-29-15-12-27-21-29/h2,4-9,12,15,18,21,30H,3,10-11,13-14,16-17,19-20H2,1H3 |
| InChIKey | CHRLZKUZDUBACY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |