C25H30FN3O3 — CID 132772516
4-[(2-fluorophenoxy)methyl]-1-[[3-(2-imidazol-1-ylethoxy)phenyl]methyl]azepan-4-ol (PubChem CID 132772516) has the molecular formula C25H30FN3O3 and a molecular weight of 439.53 g/mol. Its IUPAC name is 4-[(2-fluorophenoxy)methyl]-1-[[3-(2-imidazol-1-ylethoxy)phenyl]methyl]azepan-4-ol.
| Compound Name | 4-[(2-fluorophenoxy)methyl]-1-[[3-(2-imidazol-1-ylethoxy)phenyl]methyl]azepan-4-ol |
|---|---|
| PubChem CID | 132772516 |
| Molecular Formula | C25H30FN3O3 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 4-[(2-fluorophenoxy)methyl]-1-[[3-(2-imidazol-1-ylethoxy)phenyl]methyl]azepan-4-ol |
| SMILES | OC1(COc2ccccc2F)CCCN(Cc2cccc(OCCn3ccnc3)c2)CC1 |
| InChI | InChI=1S/C25H30FN3O3/c26-23-7-1-2-8-24(23)32-19-25(30)9-4-12-28(13-10-25)18-21-5-3-6-22(17-21)31-16-15-29-14-11-27-20-29/h1-3,5-8,11,14,17,20,30H,4,9-10,12-13,15-16,18-19H2 |
| InChIKey | OWIWONQJOZOAKE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |