C27H33FN4O4 — CID 132773849
1-[6-[(4-fluorophenoxy)methyl]-6-hydroxy-4-[[3-(3-imidazol-1-ylpropoxy)phenyl]methyl]-1,4-diazepan-1-yl]ethanone (PubChem CID 132773849) has the molecular formula C27H33FN4O4 and a molecular weight of 496.58 g/mol. Its IUPAC name is 1-[6-[(4-fluorophenoxy)methyl]-6-hydroxy-4-[[3-(3-imidazol-1-ylpropoxy)phenyl]methyl]-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[6-[(4-fluorophenoxy)methyl]-6-hydroxy-4-[[3-(3-imidazol-1-ylpropoxy)phenyl]methyl]-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 132773849 |
| Molecular Formula | C27H33FN4O4 |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 1-[6-[(4-fluorophenoxy)methyl]-6-hydroxy-4-[[3-(3-imidazol-1-ylpropoxy)phenyl]methyl]-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(Cc2cccc(OCCCn3ccnc3)c2)CC(O)(COc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C27H33FN4O4/c1-22(33)32-14-13-31(18-27(34,19-32)20-36-25-8-6-24(28)7-9-25)17-23-4-2-5-26(16-23)35-15-3-11-30-12-10-29-21-30/h2,4-10,12,16,21,34H,3,11,13-15,17-20H2,1H3 |
| InChIKey | HGDIJYXFYMGHFU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|