C28H38N2O4 — CID 132767717
1-[3-[3-[[4-hydroxy-4-[(4-methylphenoxy)methyl]azepan-1-yl]methyl]phenoxy]propyl]pyrrolidin-2-one (PubChem CID 132767717) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is 1-[3-[3-[[4-hydroxy-4-[(4-methylphenoxy)methyl]azepan-1-yl]methyl]phenoxy]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[3-[[4-hydroxy-4-[(4-methylphenoxy)methyl]azepan-1-yl]methyl]phenoxy]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 132767717 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 1-[3-[3-[[4-hydroxy-4-[(4-methylphenoxy)methyl]azepan-1-yl]methyl]phenoxy]propyl]pyrrolidin-2-one |
| SMILES | Cc1ccc(OCC2(O)CCCN(Cc3cccc(OCCCN4CCCC4=O)c3)CC2)cc1 |
| InChI | InChI=1S/C28H38N2O4/c1-23-9-11-25(12-10-23)34-22-28(32)13-4-15-29(18-14-28)21-24-6-2-7-26(20-24)33-19-5-17-30-16-3-8-27(30)31/h2,6-7,9-12,20,32H,3-5,8,13-19,21-22H2,1H3 |
| InChIKey | LKFCNCKUVPWHQW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|