C32H46N2O5 — CID 132769266
1-[3-[5-[[4-[(2,4-dimethylphenoxy)methyl]-4-hydroxyazepan-1-yl]methyl]-2-methoxyphenoxy]propyl]azepan-2-one (PubChem CID 132769266) has the molecular formula C32H46N2O5 and a molecular weight of 538.73 g/mol. Its IUPAC name is 1-[3-[5-[[4-[(2,4-dimethylphenoxy)methyl]-4-hydroxyazepan-1-yl]methyl]-2-methoxyphenoxy]propyl]azepan-2-one.
| Compound Name | 1-[3-[5-[[4-[(2,4-dimethylphenoxy)methyl]-4-hydroxyazepan-1-yl]methyl]-2-methoxyphenoxy]propyl]azepan-2-one |
|---|---|
| PubChem CID | 132769266 |
| Molecular Formula | C32H46N2O5 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.34 |
| IUPAC Name | 1-[3-[5-[[4-[(2,4-dimethylphenoxy)methyl]-4-hydroxyazepan-1-yl]methyl]-2-methoxyphenoxy]propyl]azepan-2-one |
| SMILES | COc1ccc(CN2CCCC(O)(COc3ccc(C)cc3C)CC2)cc1OCCCN1CCCCCC1=O |
| InChI | InChI=1S/C32H46N2O5/c1-25-10-12-28(26(2)21-25)39-24-32(36)14-7-16-33(19-15-32)23-27-11-13-29(37-3)30(22-27)38-20-8-18-34-17-6-4-5-9-31(34)35/h10-13,21-22,36H,4-9,14-20,23-24H2,1-3H3 |
| InChIKey | RPDBDSVVSCCDCE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|