C29H39N3O3 — CID 132768033
4-[(2,4-dimethylphenoxy)methyl]-1-[[4-[3-(2-methylimidazol-1-yl)propoxy]phenyl]methyl]azepan-4-ol (PubChem CID 132768033) has the molecular formula C29H39N3O3 and a molecular weight of 477.65 g/mol. Its IUPAC name is 4-[(2,4-dimethylphenoxy)methyl]-1-[[4-[3-(2-methylimidazol-1-yl)propoxy]phenyl]methyl]azepan-4-ol.
| Compound Name | 4-[(2,4-dimethylphenoxy)methyl]-1-[[4-[3-(2-methylimidazol-1-yl)propoxy]phenyl]methyl]azepan-4-ol |
|---|---|
| PubChem CID | 132768033 |
| Molecular Formula | C29H39N3O3 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | 4-[(2,4-dimethylphenoxy)methyl]-1-[[4-[3-(2-methylimidazol-1-yl)propoxy]phenyl]methyl]azepan-4-ol |
| SMILES | Cc1ccc(OCC2(O)CCCN(Cc3ccc(OCCCn4ccnc4C)cc3)CC2)c(C)c1 |
| InChI | InChI=1S/C29H39N3O3/c1-23-6-11-28(24(2)20-23)35-22-29(33)12-4-15-31(17-13-29)21-26-7-9-27(10-8-26)34-19-5-16-32-18-14-30-25(32)3/h6-11,14,18,20,33H,4-5,12-13,15-17,19,21-22H2,1-3H3 |
| InChIKey | UFMMGQIJLKLNSF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|