C29H39N3O5 — CID 132768784
3-[3-[4-[[4-hydroxy-4-[(4-methylphenoxy)methyl]azepan-1-yl]methyl]phenoxy]propyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 132768784) has the molecular formula C29H39N3O5 and a molecular weight of 509.65 g/mol. Its IUPAC name is 3-[3-[4-[[4-hydroxy-4-[(4-methylphenoxy)methyl]azepan-1-yl]methyl]phenoxy]propyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[3-[4-[[4-hydroxy-4-[(4-methylphenoxy)methyl]azepan-1-yl]methyl]phenoxy]propyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 132768784 |
| Molecular Formula | C29H39N3O5 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | 3-[3-[4-[[4-hydroxy-4-[(4-methylphenoxy)methyl]azepan-1-yl]methyl]phenoxy]propyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | Cc1ccc(OCC2(O)CCCN(Cc3ccc(OCCCN4C(=O)NC(C)(C)C4=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H39N3O5/c1-22-6-10-25(11-7-22)37-21-29(35)14-4-16-31(18-15-29)20-23-8-12-24(13-9-23)36-19-5-17-32-26(33)28(2,3)30-27(32)34/h6-13,35H,4-5,14-21H2,1-3H3,(H,30,34) |
| InChIKey | JPKWUVQKLBQQJK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|