C27H36N2O5 — CID 132767785
1-[3-[3-[[6-hydroxy-6-[(4-methylphenoxy)methyl]-1,4-oxazepan-4-yl]methyl]phenoxy]propyl]pyrrolidin-2-one (PubChem CID 132767785) has the molecular formula C27H36N2O5 and a molecular weight of 468.59 g/mol. Its IUPAC name is 1-[3-[3-[[6-hydroxy-6-[(4-methylphenoxy)methyl]-1,4-oxazepan-4-yl]methyl]phenoxy]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[3-[[6-hydroxy-6-[(4-methylphenoxy)methyl]-1,4-oxazepan-4-yl]methyl]phenoxy]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 132767785 |
| Molecular Formula | C27H36N2O5 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 1-[3-[3-[[6-hydroxy-6-[(4-methylphenoxy)methyl]-1,4-oxazepan-4-yl]methyl]phenoxy]propyl]pyrrolidin-2-one |
| SMILES | Cc1ccc(OCC2(O)COCCN(Cc3cccc(OCCCN4CCCC4=O)c3)C2)cc1 |
| InChI | InChI=1S/C27H36N2O5/c1-22-8-10-24(11-9-22)34-21-27(31)19-28(14-16-32-20-27)18-23-5-2-6-25(17-23)33-15-4-13-29-12-3-7-26(29)30/h2,5-6,8-11,17,31H,3-4,7,12-16,18-21H2,1H3 |
| InChIKey | RUQCXRYMNYBGMO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|