C27H34ClN3O4 — CID 132768621
6-[(4-chlorophenoxy)methyl]-4-[[3-[3-(3,5-dimethylpyrazol-1-yl)propoxy]phenyl]methyl]-1,4-oxazepan-6-ol (PubChem CID 132768621) has the molecular formula C27H34ClN3O4 and a molecular weight of 500.04 g/mol. Its IUPAC name is 6-[(4-chlorophenoxy)methyl]-4-[[3-[3-(3,5-dimethylpyrazol-1-yl)propoxy]phenyl]methyl]-1,4-oxazepan-6-ol.
| Compound Name | 6-[(4-chlorophenoxy)methyl]-4-[[3-[3-(3,5-dimethylpyrazol-1-yl)propoxy]phenyl]methyl]-1,4-oxazepan-6-ol |
|---|---|
| PubChem CID | 132768621 |
| Molecular Formula | C27H34ClN3O4 |
| Molecular Weight | 500.04 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | 6-[(4-chlorophenoxy)methyl]-4-[[3-[3-(3,5-dimethylpyrazol-1-yl)propoxy]phenyl]methyl]-1,4-oxazepan-6-ol |
| SMILES | Cc1cc(C)n(CCCOc2cccc(CN3CCOCC(O)(COc4ccc(Cl)cc4)C3)c2)n1 |
| InChI | InChI=1S/C27H34ClN3O4/c1-21-15-22(2)31(29-21)11-4-13-34-26-6-3-5-23(16-26)17-30-12-14-33-19-27(32,18-30)20-35-25-9-7-24(28)8-10-25/h3,5-10,15-16,32H,4,11-14,17-20H2,1-2H3 |
| InChIKey | UFYBTHKKCRPKCU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 68.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.04 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|