C27H34FN3O4 — CID 155993489
(3S,4S)-1-[[3-[3-(3,5-dimethylpyrazol-1-yl)propoxy]phenyl]methyl]-3-[(4-fluorophenoxy)methyl]piperidine-3,4-diol (PubChem CID 155993489) has the molecular formula C27H34FN3O4 and a molecular weight of 483.58 g/mol. Its IUPAC name is (3S,4S)-1-[[3-[3-(3,5-dimethylpyrazol-1-yl)propoxy]phenyl]methyl]-3-[(4-fluorophenoxy)methyl]piperidine-3,4-diol.
| Compound Name | (3S,4S)-1-[[3-[3-(3,5-dimethylpyrazol-1-yl)propoxy]phenyl]methyl]-3-[(4-fluorophenoxy)methyl]piperidine-3,4-diol |
|---|---|
| PubChem CID | 155993489 |
| Molecular Formula | C27H34FN3O4 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | (3S,4S)-1-[[3-[3-(3,5-dimethylpyrazol-1-yl)propoxy]phenyl]methyl]-3-[(4-fluorophenoxy)methyl]piperidine-3,4-diol |
| SMILES | Cc1cc(C)n(CCCOc2cccc(CN3CC[C@H](O)[C@@](O)(COc4ccc(F)cc4)C3)c2)n1 |
| InChI | InChI=1S/C27H34FN3O4/c1-20-15-21(2)31(29-20)12-4-14-34-25-6-3-5-22(16-25)17-30-13-11-26(32)27(33,18-30)19-35-24-9-7-23(28)8-10-24/h3,5-10,15-16,26,32-33H,4,11-14,17-19H2,1-2H3/t26-,27-/m0/s1 |
| InChIKey | KAKWILPKSWALSO-SVBPBHIXSA-N |
| XLogP | 3.48 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|