C25H28F3N3O5 — CID 155994151
(3S,4S)-1-[[3-(2-imidazol-1-ylethoxy)-4-methoxyphenyl]methyl]-3-[(3,4,5-trifluorophenoxy)methyl]piperidine-3,4-diol (PubChem CID 155994151) has the molecular formula C25H28F3N3O5 and a molecular weight of 507.51 g/mol. Its IUPAC name is (3S,4S)-1-[[3-(2-imidazol-1-ylethoxy)-4-methoxyphenyl]methyl]-3-[(3,4,5-trifluorophenoxy)methyl]piperidine-3,4-diol.
| Compound Name | (3S,4S)-1-[[3-(2-imidazol-1-ylethoxy)-4-methoxyphenyl]methyl]-3-[(3,4,5-trifluorophenoxy)methyl]piperidine-3,4-diol |
|---|---|
| PubChem CID | 155994151 |
| Molecular Formula | C25H28F3N3O5 |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | (3S,4S)-1-[[3-(2-imidazol-1-ylethoxy)-4-methoxyphenyl]methyl]-3-[(3,4,5-trifluorophenoxy)methyl]piperidine-3,4-diol |
| SMILES | COc1ccc(CN2CC[C@H](O)[C@@](O)(COc3cc(F)c(F)c(F)c3)C2)cc1OCCn1ccnc1 |
| InChI | InChI=1S/C25H28F3N3O5/c1-34-21-3-2-17(10-22(21)35-9-8-30-7-5-29-16-30)13-31-6-4-23(32)25(33,14-31)15-36-18-11-19(26)24(28)20(27)12-18/h2-3,5,7,10-12,16,23,32-33H,4,6,8-9,13-15H2,1H3/t23-,25-/m0/s1 |
| InChIKey | UEOCVTGFPSXFHI-ZCYQVOJMSA-N |
| XLogP | 2.76 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|