C28H36ClN3O5 — CID 155993349
(3S,4S)-3-[(4-chloro-3,5-dimethylphenoxy)methyl]-1-[[4-methoxy-3-(3-pyrazol-1-ylpropoxy)phenyl]methyl]piperidine-3,4-diol (PubChem CID 155993349) has the molecular formula C28H36ClN3O5 and a molecular weight of 530.07 g/mol. Its IUPAC name is (3S,4S)-3-[(4-chloro-3,5-dimethylphenoxy)methyl]-1-[[4-methoxy-3-(3-pyrazol-1-ylpropoxy)phenyl]methyl]piperidine-3,4-diol.
| Compound Name | (3S,4S)-3-[(4-chloro-3,5-dimethylphenoxy)methyl]-1-[[4-methoxy-3-(3-pyrazol-1-ylpropoxy)phenyl]methyl]piperidine-3,4-diol |
|---|---|
| PubChem CID | 155993349 |
| Molecular Formula | C28H36ClN3O5 |
| Molecular Weight | 530.07 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | (3S,4S)-3-[(4-chloro-3,5-dimethylphenoxy)methyl]-1-[[4-methoxy-3-(3-pyrazol-1-ylpropoxy)phenyl]methyl]piperidine-3,4-diol |
| SMILES | COc1ccc(CN2CC[C@H](O)[C@@](O)(COc3cc(C)c(Cl)c(C)c3)C2)cc1OCCCn1cccn1 |
| InChI | InChI=1S/C28H36ClN3O5/c1-20-14-23(15-21(2)27(20)29)37-19-28(34)18-31(12-8-26(28)33)17-22-6-7-24(35-3)25(16-22)36-13-5-11-32-10-4-9-30-32/h4,6-7,9-10,14-16,26,33-34H,5,8,11-13,17-19H2,1-3H3/t26-,28-/m0/s1 |
| InChIKey | ZFRWXXVQFJKZCQ-XCZPVHLTSA-N |
| XLogP | 4.01 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.07 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|