C27H34ClN3O4 — CID 155993505
(3S,4S)-3-[(4-chlorophenoxy)methyl]-1-[[3-[3-(2-ethylimidazol-1-yl)propoxy]phenyl]methyl]piperidine-3,4-diol (PubChem CID 155993505) has the molecular formula C27H34ClN3O4 and a molecular weight of 500.04 g/mol. Its IUPAC name is (3S,4S)-3-[(4-chlorophenoxy)methyl]-1-[[3-[3-(2-ethylimidazol-1-yl)propoxy]phenyl]methyl]piperidine-3,4-diol.
| Compound Name | (3S,4S)-3-[(4-chlorophenoxy)methyl]-1-[[3-[3-(2-ethylimidazol-1-yl)propoxy]phenyl]methyl]piperidine-3,4-diol |
|---|---|
| PubChem CID | 155993505 |
| Molecular Formula | C27H34ClN3O4 |
| Molecular Weight | 500.04 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | (3S,4S)-3-[(4-chlorophenoxy)methyl]-1-[[3-[3-(2-ethylimidazol-1-yl)propoxy]phenyl]methyl]piperidine-3,4-diol |
| SMILES | CCc1nccn1CCCOc1cccc(CN2CC[C@H](O)[C@@](O)(COc3ccc(Cl)cc3)C2)c1 |
| InChI | InChI=1S/C27H34ClN3O4/c1-2-26-29-12-15-31(26)13-4-16-34-24-6-3-5-21(17-24)18-30-14-11-25(32)27(33,19-30)20-35-23-9-7-22(28)8-10-23/h3,5-10,12,15,17,25,32-33H,2,4,11,13-14,16,18-20H2,1H3/t25-,27-/m0/s1 |
| InChIKey | YQMXOUXBZPUGBR-BDYUSTAISA-N |
| XLogP | 3.94 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.04 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|