C29H39N3O5 — CID 132768790
4-[[4-[3-(2-ethylimidazol-1-yl)propoxy]-3-methoxyphenyl]methyl]-6-[(3-methylphenoxy)methyl]-1,4-oxazepan-6-ol (PubChem CID 132768790) has the molecular formula C29H39N3O5 and a molecular weight of 509.65 g/mol. Its IUPAC name is 4-[[4-[3-(2-ethylimidazol-1-yl)propoxy]-3-methoxyphenyl]methyl]-6-[(3-methylphenoxy)methyl]-1,4-oxazepan-6-ol.
| Compound Name | 4-[[4-[3-(2-ethylimidazol-1-yl)propoxy]-3-methoxyphenyl]methyl]-6-[(3-methylphenoxy)methyl]-1,4-oxazepan-6-ol |
|---|---|
| PubChem CID | 132768790 |
| Molecular Formula | C29H39N3O5 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | 4-[[4-[3-(2-ethylimidazol-1-yl)propoxy]-3-methoxyphenyl]methyl]-6-[(3-methylphenoxy)methyl]-1,4-oxazepan-6-ol |
| SMILES | CCc1nccn1CCCOc1ccc(CN2CCOCC(O)(COc3cccc(C)c3)C2)cc1OC |
| InChI | InChI=1S/C29H39N3O5/c1-4-28-30-11-13-32(28)12-6-15-36-26-10-9-24(18-27(26)34-3)19-31-14-16-35-21-29(33,20-31)22-37-25-8-5-7-23(2)17-25/h5,7-11,13,17-18,33H,4,6,12,14-16,19-22H2,1-3H3 |
| InChIKey | LPHCOMUHNCLMSE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|