C28H37FN2O5 — CID 155993442
1-[3-[3-[[(3S,4S)-3-[(3-fluorophenoxy)methyl]-3,4-dihydroxypiperidin-1-yl]methyl]phenoxy]propyl]azepan-2-one (PubChem CID 155993442) has the molecular formula C28H37FN2O5 and a molecular weight of 500.61 g/mol. Its IUPAC name is 1-[3-[3-[[(3S,4S)-3-[(3-fluorophenoxy)methyl]-3,4-dihydroxypiperidin-1-yl]methyl]phenoxy]propyl]azepan-2-one.
| Compound Name | 1-[3-[3-[[(3S,4S)-3-[(3-fluorophenoxy)methyl]-3,4-dihydroxypiperidin-1-yl]methyl]phenoxy]propyl]azepan-2-one |
|---|---|
| PubChem CID | 155993442 |
| Molecular Formula | C28H37FN2O5 |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | 1-[3-[3-[[(3S,4S)-3-[(3-fluorophenoxy)methyl]-3,4-dihydroxypiperidin-1-yl]methyl]phenoxy]propyl]azepan-2-one |
| SMILES | O=C1CCCCCN1CCCOc1cccc(CN2CC[C@H](O)[C@@](O)(COc3cccc(F)c3)C2)c1 |
| InChI | InChI=1S/C28H37FN2O5/c29-23-8-5-10-25(18-23)36-21-28(34)20-30(15-12-26(28)32)19-22-7-4-9-24(17-22)35-16-6-14-31-13-3-1-2-11-27(31)33/h4-5,7-10,17-18,26,32,34H,1-3,6,11-16,19-21H2/t26-,28-/m0/s1 |
| InChIKey | LALWXYKHGKKNDU-XCZPVHLTSA-N |
| XLogP | 3.37 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|