C27H33Cl2N3O4 — CID 132780891
4-[(3,4-dichlorophenoxy)methyl]-1-[[3-methoxy-4-(3-pyrazol-1-ylpropoxy)phenyl]methyl]azepan-4-ol (PubChem CID 132780891) has the molecular formula C27H33Cl2N3O4 and a molecular weight of 534.48 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenoxy)methyl]-1-[[3-methoxy-4-(3-pyrazol-1-ylpropoxy)phenyl]methyl]azepan-4-ol.
| Compound Name | 4-[(3,4-dichlorophenoxy)methyl]-1-[[3-methoxy-4-(3-pyrazol-1-ylpropoxy)phenyl]methyl]azepan-4-ol |
|---|---|
| PubChem CID | 132780891 |
| Molecular Formula | C27H33Cl2N3O4 |
| Molecular Weight | 534.48 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 4-[(3,4-dichlorophenoxy)methyl]-1-[[3-methoxy-4-(3-pyrazol-1-ylpropoxy)phenyl]methyl]azepan-4-ol |
| SMILES | COc1cc(CN2CCCC(O)(COc3ccc(Cl)c(Cl)c3)CC2)ccc1OCCCn1cccn1 |
| InChI | InChI=1S/C27H33Cl2N3O4/c1-34-26-17-21(5-8-25(26)35-16-4-14-32-13-3-11-30-32)19-31-12-2-9-27(33,10-15-31)20-36-22-6-7-23(28)24(29)18-22/h3,5-8,11,13,17-18,33H,2,4,9-10,12,14-16,19-20H2,1H3 |
| InChIKey | OLXAAYWQONGBBQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 68.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|