C27H38N2O8 — CID 171322398
(3R,4R)-3-benzyl-1-[[3-[3-(dimethylamino)propoxy]phenyl]methyl]-4-hydroxypiperidine-3-carboxylic acid;formic acid (PubChem CID 171322398) has the molecular formula C27H38N2O8 and a molecular weight of 518.61 g/mol. Its IUPAC name is (3R,4R)-3-benzyl-1-[[3-[3-(dimethylamino)propoxy]phenyl]methyl]-4-hydroxypiperidine-3-carboxylic acid;formic acid.
| Compound Name | (3R,4R)-3-benzyl-1-[[3-[3-(dimethylamino)propoxy]phenyl]methyl]-4-hydroxypiperidine-3-carboxylic acid;formic acid |
|---|---|
| PubChem CID | 171322398 |
| Molecular Formula | C27H38N2O8 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | (3R,4R)-3-benzyl-1-[[3-[3-(dimethylamino)propoxy]phenyl]methyl]-4-hydroxypiperidine-3-carboxylic acid;formic acid |
| SMILES | CN(C)CCCOc1cccc(CN2CC[C@@H](O)[C@](Cc3ccccc3)(C(=O)O)C2)c1.O=CO.O=CO |
| InChI | InChI=1S/C25H34N2O4.2CH2O2/c1-26(2)13-7-15-31-22-11-6-10-21(16-22)18-27-14-12-23(28)25(19-27,24(29)30)17-20-8-4-3-5-9-20;2*2-1-3/h3-6,8-11,16,23,28H,7,12-15,17-19H2,1-2H3,(H,29,30);2*1H,(H,2,3)/t23-,25-;;/m1../s1 |
| InChIKey | DWEJGKAEEJKRCK-BHEHKONASA-N |
| XLogP | 2.30 |
| TPSA | 147.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|