C19H28FNO7 — CID 171316833
(3R,4R)-3-[(3-fluorophenyl)methyl]-4-hydroxy-1-[2-(2-methoxyethoxy)ethyl]piperidine-3-carboxylic acid;formic acid (PubChem CID 171316833) has the molecular formula C19H28FNO7 and a molecular weight of 401.43 g/mol. Its IUPAC name is (3R,4R)-3-[(3-fluorophenyl)methyl]-4-hydroxy-1-[2-(2-methoxyethoxy)ethyl]piperidine-3-carboxylic acid;formic acid.
| Compound Name | (3R,4R)-3-[(3-fluorophenyl)methyl]-4-hydroxy-1-[2-(2-methoxyethoxy)ethyl]piperidine-3-carboxylic acid;formic acid |
|---|---|
| PubChem CID | 171316833 |
| Molecular Formula | C19H28FNO7 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | (3R,4R)-3-[(3-fluorophenyl)methyl]-4-hydroxy-1-[2-(2-methoxyethoxy)ethyl]piperidine-3-carboxylic acid;formic acid |
| SMILES | COCCOCCN1CC[C@@H](O)[C@](Cc2cccc(F)c2)(C(=O)O)C1.O=CO |
| InChI | InChI=1S/C18H26FNO5.CH2O2/c1-24-9-10-25-8-7-20-6-5-16(21)18(13-20,17(22)23)12-14-3-2-4-15(19)11-14;2-1-3/h2-4,11,16,21H,5-10,12-13H2,1H3,(H,22,23);1H,(H,2,3)/t16-,18-;/m1./s1 |
| InChIKey | DLSHZXAWEASLSB-PHJLCXHGSA-N |
| XLogP | 0.87 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|