C21H23FN2O6 — CID 171711374
(3R,4S)-1-(5-acetyl-2-pyridinyl)-3-[(3-fluorophenyl)methyl]-4-hydroxypiperidine-3-carboxylic acid;formic acid (PubChem CID 171711374) has the molecular formula C21H23FN2O6 and a molecular weight of 418.42 g/mol. Its IUPAC name is (3R,4S)-1-(5-acetyl-2-pyridinyl)-3-[(3-fluorophenyl)methyl]-4-hydroxypiperidine-3-carboxylic acid;formic acid.
| Compound Name | (3R,4S)-1-(5-acetyl-2-pyridinyl)-3-[(3-fluorophenyl)methyl]-4-hydroxypiperidine-3-carboxylic acid;formic acid |
|---|---|
| PubChem CID | 171711374 |
| Molecular Formula | C21H23FN2O6 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (3R,4S)-1-(5-acetyl-2-pyridinyl)-3-[(3-fluorophenyl)methyl]-4-hydroxypiperidine-3-carboxylic acid;formic acid |
| SMILES | CC(=O)c1ccc(N2CC[C@H](O)[C@](Cc3cccc(F)c3)(C(=O)O)C2)nc1.O=CO |
| InChI | InChI=1S/C20H21FN2O4.CH2O2/c1-13(24)15-5-6-18(22-11-15)23-8-7-17(25)20(12-23,19(26)27)10-14-3-2-4-16(21)9-14;2-1-3/h2-6,9,11,17,25H,7-8,10,12H2,1H3,(H,26,27);1H,(H,2,3)/t17-,20+;/m0./s1 |
| InChIKey | XDHNANUZFFEMHX-YFUYRHFLSA-N |
| XLogP | 2.01 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|