C17H19FN2O5S — CID 171707885
(3R,4S)-3-[(3-fluorophenyl)methyl]-4-hydroxy-1-(1,3-thiazol-2-yl)piperidine-3-carboxylic acid;formic acid (PubChem CID 171707885) has the molecular formula C17H19FN2O5S and a molecular weight of 382.41 g/mol. Its IUPAC name is (3R,4S)-3-[(3-fluorophenyl)methyl]-4-hydroxy-1-(1,3-thiazol-2-yl)piperidine-3-carboxylic acid;formic acid.
| Compound Name | (3R,4S)-3-[(3-fluorophenyl)methyl]-4-hydroxy-1-(1,3-thiazol-2-yl)piperidine-3-carboxylic acid;formic acid |
|---|---|
| PubChem CID | 171707885 |
| Molecular Formula | C17H19FN2O5S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | (3R,4S)-3-[(3-fluorophenyl)methyl]-4-hydroxy-1-(1,3-thiazol-2-yl)piperidine-3-carboxylic acid;formic acid |
| SMILES | O=C(O)[C@]1(Cc2cccc(F)c2)CN(c2nccs2)CC[C@@H]1O.O=CO |
| InChI | InChI=1S/C16H17FN2O3S.CH2O2/c17-12-3-1-2-11(8-12)9-16(14(21)22)10-19(6-4-13(16)20)15-18-5-7-23-15;2-1-3/h1-3,5,7-8,13,20H,4,6,9-10H2,(H,21,22);1H,(H,2,3)/t13-,16+;/m0./s1 |
| InChIKey | GMPJSMONMLOCBN-MELYUZJYSA-N |
| XLogP | 1.87 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|