C28H37N3O4 — CID 155992483
4-[[3-[3-(3,5-dimethylpyrazol-1-yl)propoxy]phenyl]methyl]-6-[(4-methylphenoxy)methyl]-1,4-oxazepan-6-ol (PubChem CID 155992483) has the molecular formula C28H37N3O4 and a molecular weight of 479.62 g/mol. Its IUPAC name is 4-[[3-[3-(3,5-dimethylpyrazol-1-yl)propoxy]phenyl]methyl]-6-[(4-methylphenoxy)methyl]-1,4-oxazepan-6-ol.
| Compound Name | 4-[[3-[3-(3,5-dimethylpyrazol-1-yl)propoxy]phenyl]methyl]-6-[(4-methylphenoxy)methyl]-1,4-oxazepan-6-ol |
|---|---|
| PubChem CID | 155992483 |
| Molecular Formula | C28H37N3O4 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | 4-[[3-[3-(3,5-dimethylpyrazol-1-yl)propoxy]phenyl]methyl]-6-[(4-methylphenoxy)methyl]-1,4-oxazepan-6-ol |
| SMILES | Cc1ccc(OCC2(O)COCCN(Cc3cccc(OCCCn4nc(C)cc4C)c3)C2)cc1 |
| InChI | InChI=1S/C28H37N3O4/c1-22-8-10-26(11-9-22)35-21-28(32)19-30(13-15-33-20-28)18-25-6-4-7-27(17-25)34-14-5-12-31-24(3)16-23(2)29-31/h4,6-11,16-17,32H,5,12-15,18-21H2,1-3H3 |
| InChIKey | GDYVSAHUXSEWDB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 68.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|